C36H46F6N2S — CID 162470469
N-[3,5-bis(trifluoromethyl)phenyl]-2,18-dimethyl-17-(6-methylheptan-2-yl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine (PubChem CID 162470469) has the molecular formula C36H46F6N2S and a molecular weight of 652.83 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2,18-dimethyl-17-(6-methylheptan-2-yl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2,18-dimethyl-17-(6-methylheptan-2-yl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine |
|---|---|
| PubChem CID | 162470469 |
| Molecular Formula | C36H46F6N2S |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2,18-dimethyl-17-(6-methylheptan-2-yl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4c5sc(Nc6cc(C(F)(F)F)cc(C(F)(F)F)c6)nc5CCC4(C)C3CCC12C |
| InChI | InChI=1S/C36H46F6N2S/c1-20(2)7-6-8-21(3)26-11-12-27-25-9-10-29-31-30(14-16-34(29,5)28(25)13-15-33(26,27)4)44-32(45-31)43-24-18-22(35(37,38)39)17-23(19-24)36(40,41)42/h10,17-21,25-28H,6-9,11-16H2,1-5H3,(H,43,44) |
| InChIKey | UMSBVEQFVPUMNN-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |