C24H32O2S — CID 99573540
(8R,9S,10R,13S,14S,17S)-3-(5-methoxythiophen-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 99573540) has the molecular formula C24H32O2S and a molecular weight of 384.59 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-3-(5-methoxythiophen-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,10R,13S,14S,17S)-3-(5-methoxythiophen-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 99573540 |
| Molecular Formula | C24H32O2S |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-3-(5-methoxythiophen-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | COc1ccc(C2=CC3=CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]4[C@@]3(C)CC2)s1 |
| InChI | InChI=1S/C24H32O2S/c1-23-12-10-15(20-7-9-22(26-3)27-20)14-16(23)4-5-17-18-6-8-21(25)24(18,2)13-11-19(17)23/h4,7,9,14,17-19,21,25H,5-6,8,10-13H2,1-3H3/t17-,18-,19-,21-,23-,24-/m0/s1 |
| InChIKey | WGEUFSKQOAMPKS-QRPBXLKNSA-N |
| XLogP | 6.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |