C30H36N2OS — CID 169426049
(1S,2R,13R,14S,17R,18S)-7-(3,5-dimethylanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol (PubChem CID 169426049) has the molecular formula C30H36N2OS and a molecular weight of 472.70 g/mol. Its IUPAC name is (1S,2R,13R,14S,17R,18S)-7-(3,5-dimethylanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol.
| Compound Name | (1S,2R,13R,14S,17R,18S)-7-(3,5-dimethylanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
|---|---|
| PubChem CID | 169426049 |
| Molecular Formula | C30H36N2OS |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | (1S,2R,13R,14S,17R,18S)-7-(3,5-dimethylanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CC=C4c5sc(Nc6cc(C)cc(C)c6)nc5CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C30H36N2OS/c1-6-30(33)14-10-23-21-7-8-24-26-25(11-12-28(24,4)22(21)9-13-29(23,30)5)32-27(34-26)31-20-16-18(2)15-19(3)17-20/h1,8,15-17,21-23,33H,7,9-14H2,2-5H3,(H,31,32)/t21-,22+,23+,28-,29+,30+/m1/s1 |
| InChIKey | ITTPGDNRALEPAA-MMIUZUGHSA-N |
| XLogP | 7.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|