C28H33N3O2S — CID 171392052
(1S,2R,13R,14S,17R,18S)-17-ethynyl-7-[(6-methoxy-3-pyridinyl)amino]-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol (PubChem CID 171392052) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is (1S,2R,13R,14S,17R,18S)-17-ethynyl-7-[(6-methoxy-3-pyridinyl)amino]-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol.
| Compound Name | (1S,2R,13R,14S,17R,18S)-17-ethynyl-7-[(6-methoxy-3-pyridinyl)amino]-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
|---|---|
| PubChem CID | 171392052 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (1S,2R,13R,14S,17R,18S)-17-ethynyl-7-[(6-methoxy-3-pyridinyl)amino]-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CC=C4c5sc(Nc6ccc(OC)nc6)nc5CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H33N3O2S/c1-5-28(32)15-11-20-18-7-8-21-24-22(12-13-26(21,2)19(18)10-14-27(20,28)3)31-25(34-24)30-17-6-9-23(33-4)29-16-17/h1,6,8-9,16,18-20,32H,7,10-15H2,2-4H3,(H,30,31)/t18-,19+,20+,26-,27+,28+/m1/s1 |
| InChIKey | RVWUCWIBPRRSQO-AYSDIWEPSA-N |
| XLogP | 5.84 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|