C26H42N2O — CID 25218182
(3R,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 25218182) has the molecular formula C26H42N2O and a molecular weight of 398.64 g/mol. Its IUPAC name is (3R,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3R,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 25218182 |
| Molecular Formula | C26H42N2O |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | (3R,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C#C[C@]1(O)CCC2C3CCC4=C[C@H](NCCNC(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H42N2O/c1-6-26(29)14-11-23-21-8-7-19-17-20(28-16-15-27-18(2)3)9-12-24(19,4)22(21)10-13-25(23,26)5/h1,17-18,20-23,27-29H,7-16H2,2-5H3/t20-,21?,22?,23?,24+,25+,26+/m1/s1 |
| InChIKey | NQEGSYYJVQDOSH-HAGXMYRUSA-N |
| XLogP | 4.27 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|