C27H43NO — CID 159315670
(3S,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-(4-methylpentylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 159315670) has the molecular formula C27H43NO and a molecular weight of 397.65 g/mol. Its IUPAC name is (3S,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-(4-methylpentylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3S,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-(4-methylpentylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 159315670 |
| Molecular Formula | C27H43NO |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.33 |
| IUPAC Name | (3S,10R,13S,17R)-17-ethynyl-10,13-dimethyl-3-(4-methylpentylamino)-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C#C[C@]1(O)CCC2C3CCC4=C[C@@H](NCCCC(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H43NO/c1-6-27(29)16-13-24-22-10-9-20-18-21(28-17-7-8-19(2)3)11-14-25(20,4)23(22)12-15-26(24,27)5/h1,18-19,21-24,28-29H,7-17H2,2-5H3/t21-,22?,23?,24?,25-,26-,27-/m0/s1 |
| InChIKey | LDCJNIAQWWUODZ-ATZSCKIZSA-N |
| XLogP | 5.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|