C31H56N2 — CID 24816413
N'-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butane-1,4-diamine (PubChem CID 24816413) has the molecular formula C31H56N2 and a molecular weight of 456.80 g/mol. Its IUPAC name is N'-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butane-1,4-diamine.
| Compound Name | N'-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 24816413 |
| Molecular Formula | C31H56N2 |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.44 |
| IUPAC Name | N'-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butane-1,4-diamine |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CCC4=C[C@@H](NCCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H56N2/c1-22(2)9-8-10-23(3)27-13-14-28-26-12-11-24-21-25(33-20-7-6-19-32)15-17-30(24,4)29(26)16-18-31(27,28)5/h21-23,25-29,33H,6-20,32H2,1-5H3/t23-,25+,26?,27?,28?,29?,30+,31-/m1/s1 |
| InChIKey | DFCJPXSNVVSICP-WZTTUODTSA-N |
| XLogP | 7.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|