C33H62N4 — CID 56594126
N'-[(3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-(6-aminohexylamino)ethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexane-1,6-diamine (PubChem CID 56594126) has the molecular formula C33H62N4 and a molecular weight of 514.89 g/mol. Its IUPAC name is N'-[(3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-(6-aminohexylamino)ethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexane-1,6-diamine.
| Compound Name | N'-[(3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-(6-aminohexylamino)ethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 56594126 |
| Molecular Formula | C33H62N4 |
| Molecular Weight | 514.89 g/mol |
| Exact Mass | 514.50 |
| IUPAC Name | N'-[(3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-(6-aminohexylamino)ethyl]-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]hexane-1,6-diamine |
| SMILES | C[C@@H](NCCCCCCN)[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@@H](NCCCCCCN)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H62N4/c1-25(36-22-10-6-4-8-20-34)29-14-15-30-28-13-12-26-24-27(37-23-11-7-5-9-21-35)16-18-32(26,2)31(28)17-19-33(29,30)3/h24-25,27-31,36-37H,4-23,34-35H2,1-3H3/t25-,27+,28+,29-,30+,31+,32+,33-/m1/s1 |
| InChIKey | WJWOEQVNBJYDRI-IJXDZZBXSA-N |
| XLogP | 6.54 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.89 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|