C24H42N2O — CID 59624970
(10R,13S,17S)-10,13-dimethyl-17-[1-[2-(methylamino)ethylamino]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 59624970) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is (10R,13S,17S)-10,13-dimethyl-17-[1-[2-(methylamino)ethylamino]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10R,13S,17S)-10,13-dimethyl-17-[1-[2-(methylamino)ethylamino]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59624970 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | (10R,13S,17S)-10,13-dimethyl-17-[1-[2-(methylamino)ethylamino]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CNCCNC(C)[C@H]1CCC2C3CC=C4CC(O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H42N2O/c1-16(26-14-13-25-4)20-7-8-21-19-6-5-17-15-18(27)9-11-23(17,2)22(19)10-12-24(20,21)3/h5,16,18-22,25-27H,6-15H2,1-4H3/t16?,18?,19?,20-,21?,22?,23+,24-/m1/s1 |
| InChIKey | WTQSPQIENDNOKQ-MRMXEUCSSA-N |
| XLogP | 4.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|