C26H30O2 — CID 11653674
(2E)-2-benzylidene-10,13-dimethyl-1,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 11653674) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is (2E)-2-benzylidene-10,13-dimethyl-1,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (2E)-2-benzylidene-10,13-dimethyl-1,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 11653674 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (2E)-2-benzylidene-10,13-dimethyl-1,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC12CCC3C(CC=C4CC(=O)/C(=C/c5ccccc5)CC43C)C1CCC2=O |
| InChI | InChI=1S/C26H30O2/c1-25-13-12-22-20(21(25)10-11-24(25)28)9-8-19-15-23(27)18(16-26(19,22)2)14-17-6-4-3-5-7-17/h3-8,14,20-22H,9-13,15-16H2,1-2H3/b18-14+ |
| InChIKey | SLCBIYGYXYWMJF-NBVRZTHBSA-N |
| XLogP | 5.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|