C13H23NOS — CID 129214742
5-(3-methylnonan-3-yl)-3H-1,3-thiazol-2-one (PubChem CID 129214742) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 5-(3-methylnonan-3-yl)-3H-1,3-thiazol-2-one.
| Compound Name | 5-(3-methylnonan-3-yl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 129214742 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 5-(3-methylnonan-3-yl)-3H-1,3-thiazol-2-one |
| SMILES | CCCCCCC(C)(CC)c1c[nH]c(=O)s1 |
| InChI | InChI=1S/C13H23NOS/c1-4-6-7-8-9-13(3,5-2)11-10-14-12(15)16-11/h10H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | ZHUXRNUTRCGZEZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|