C15H25NS — CID 126514041
3-ethenyl-5-(3-methylnonan-3-yl)-1,2-thiazole (PubChem CID 126514041) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 3-ethenyl-5-(3-methylnonan-3-yl)-1,2-thiazole.
| Compound Name | 3-ethenyl-5-(3-methylnonan-3-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 126514041 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-ethenyl-5-(3-methylnonan-3-yl)-1,2-thiazole |
| SMILES | C=Cc1cc(C(C)(CC)CCCCCC)sn1 |
| InChI | InChI=1S/C15H25NS/c1-5-8-9-10-11-15(4,7-3)14-12-13(6-2)16-17-14/h6,12H,2,5,7-11H2,1,3-4H3 |
| InChIKey | BMWYQBGEOHEHKY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|