C16H29NOS — CID 146376933
3-methoxy-5-(5-methylundecan-5-yl)-1,2-thiazole (PubChem CID 146376933) has the molecular formula C16H29NOS and a molecular weight of 283.48 g/mol. Its IUPAC name is 3-methoxy-5-(5-methylundecan-5-yl)-1,2-thiazole.
| Compound Name | 3-methoxy-5-(5-methylundecan-5-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 146376933 |
| Molecular Formula | C16H29NOS |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 3-methoxy-5-(5-methylundecan-5-yl)-1,2-thiazole |
| SMILES | CCCCCCC(C)(CCCC)c1cc(OC)ns1 |
| InChI | InChI=1S/C16H29NOS/c1-5-7-9-10-12-16(3,11-8-6-2)14-13-15(18-4)17-19-14/h13H,5-12H2,1-4H3 |
| InChIKey | NJQABUWEWQFLJP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|