C17H30ClNO2 — CID 146379373
5-chloro-2-methoxy-4-(5-methyldodecan-5-yl)-1,3-oxazole (PubChem CID 146379373) has the molecular formula C17H30ClNO2 and a molecular weight of 315.89 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-(5-methyldodecan-5-yl)-1,3-oxazole.
| Compound Name | 5-chloro-2-methoxy-4-(5-methyldodecan-5-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 146379373 |
| Molecular Formula | C17H30ClNO2 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 5-chloro-2-methoxy-4-(5-methyldodecan-5-yl)-1,3-oxazole |
| SMILES | CCCCCCCC(C)(CCCC)c1nc(OC)oc1Cl |
| InChI | InChI=1S/C17H30ClNO2/c1-5-7-9-10-11-13-17(3,12-8-6-2)14-15(18)21-16(19-14)20-4/h5-13H2,1-4H3 |
| InChIKey | MNXWTKVBGFJRMW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|