C17H30INO — CID 146378264
2-iodo-5-methyl-4-(5-methyldodecan-5-yl)-1,3-oxazole (PubChem CID 146378264) has the molecular formula C17H30INO and a molecular weight of 391.34 g/mol. Its IUPAC name is 2-iodo-5-methyl-4-(5-methyldodecan-5-yl)-1,3-oxazole.
| Compound Name | 2-iodo-5-methyl-4-(5-methyldodecan-5-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 146378264 |
| Molecular Formula | C17H30INO |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-iodo-5-methyl-4-(5-methyldodecan-5-yl)-1,3-oxazole |
| SMILES | CCCCCCCC(C)(CCCC)c1nc(I)oc1C |
| InChI | InChI=1S/C17H30INO/c1-5-7-9-10-11-13-17(4,12-8-6-2)15-14(3)20-16(18)19-15/h5-13H2,1-4H3 |
| InChIKey | ASAZWOKDOXEXCN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|