C12H19BrFNO — CID 146378755
5-bromo-2-fluoro-4-(4-methyloctan-4-yl)-1,3-oxazole (PubChem CID 146378755) has the molecular formula C12H19BrFNO and a molecular weight of 292.19 g/mol. Its IUPAC name is 5-bromo-2-fluoro-4-(4-methyloctan-4-yl)-1,3-oxazole.
| Compound Name | 5-bromo-2-fluoro-4-(4-methyloctan-4-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 146378755 |
| Molecular Formula | C12H19BrFNO |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-bromo-2-fluoro-4-(4-methyloctan-4-yl)-1,3-oxazole |
| SMILES | CCCCC(C)(CCC)c1nc(F)oc1Br |
| InChI | InChI=1S/C12H19BrFNO/c1-4-6-8-12(3,7-5-2)9-10(13)16-11(14)15-9/h4-8H2,1-3H3 |
| InChIKey | QDQKTWSJRLKDJC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |