C16H27BrINS — CID 146379768
2-bromo-4-iodo-5-(6-methyldodecan-6-yl)-1,3-thiazole (PubChem CID 146379768) has the molecular formula C16H27BrINS and a molecular weight of 472.27 g/mol. Its IUPAC name is 2-bromo-4-iodo-5-(6-methyldodecan-6-yl)-1,3-thiazole.
| Compound Name | 2-bromo-4-iodo-5-(6-methyldodecan-6-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 146379768 |
| Molecular Formula | C16H27BrINS |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 2-bromo-4-iodo-5-(6-methyldodecan-6-yl)-1,3-thiazole |
| SMILES | CCCCCCC(C)(CCCCC)c1sc(Br)nc1I |
| InChI | InChI=1S/C16H27BrINS/c1-4-6-8-10-12-16(3,11-9-7-5-2)13-14(18)19-15(17)20-13/h4-12H2,1-3H3 |
| InChIKey | YYSXDEPIETWWFZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|