C18H34N2O2 — CID 146379321
4-methoxy-N-methyl-5-(5-methyldodecan-5-yl)-1,3-oxazol-2-amine (PubChem CID 146379321) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 4-methoxy-N-methyl-5-(5-methyldodecan-5-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-methoxy-N-methyl-5-(5-methyldodecan-5-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 146379321 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 4-methoxy-N-methyl-5-(5-methyldodecan-5-yl)-1,3-oxazol-2-amine |
| SMILES | CCCCCCCC(C)(CCCC)c1oc(NC)nc1OC |
| InChI | InChI=1S/C18H34N2O2/c1-6-8-10-11-12-14-18(3,13-9-7-2)15-16(21-5)20-17(19-4)22-15/h6-14H2,1-5H3,(H,19,20) |
| InChIKey | DYQGQULPGWHQIG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|