C16H27NS — CID 155109996
3-ethenyl-4-(3-methyldecan-3-yl)-1,2-thiazole (PubChem CID 155109996) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is 3-ethenyl-4-(3-methyldecan-3-yl)-1,2-thiazole.
| Compound Name | 3-ethenyl-4-(3-methyldecan-3-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 155109996 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 3-ethenyl-4-(3-methyldecan-3-yl)-1,2-thiazole |
| SMILES | C=Cc1nscc1C(C)(CC)CCCCCCC |
| InChI | InChI=1S/C16H27NS/c1-5-8-9-10-11-12-16(4,7-3)14-13-18-17-15(14)6-2/h6,13H,2,5,7-12H2,1,3-4H3 |
| InChIKey | LSZUSOZQZMIWKG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|