C20H36N2 — CID 167094263
3-ethenyl-1-methyl-5-(6-methyltridecan-6-yl)pyrazole (PubChem CID 167094263) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 3-ethenyl-1-methyl-5-(6-methyltridecan-6-yl)pyrazole.
| Compound Name | 3-ethenyl-1-methyl-5-(6-methyltridecan-6-yl)pyrazole |
|---|---|
| PubChem CID | 167094263 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 3-ethenyl-1-methyl-5-(6-methyltridecan-6-yl)pyrazole |
| SMILES | C=Cc1cc(C(C)(CCCCC)CCCCCCC)n(C)n1 |
| InChI | InChI=1S/C20H36N2/c1-6-9-11-12-14-16-20(4,15-13-10-7-2)19-17-18(8-3)21-22(19)5/h8,17H,3,6-7,9-16H2,1-2,4-5H3 |
| InChIKey | DIKALVUOTNXGHD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|