C17H32N2O2 — CID 154968110
3-methyl-5-(7-methyltridecan-7-yl)-1,3,4-oxadiazol-2-one (PubChem CID 154968110) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-methyl-5-(7-methyltridecan-7-yl)-1,3,4-oxadiazol-2-one.
| Compound Name | 3-methyl-5-(7-methyltridecan-7-yl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 154968110 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 3-methyl-5-(7-methyltridecan-7-yl)-1,3,4-oxadiazol-2-one |
| SMILES | CCCCCCC(C)(CCCCCC)c1nn(C)c(=O)o1 |
| InChI | InChI=1S/C17H32N2O2/c1-5-7-9-11-13-17(3,14-12-10-8-6-2)15-18-19(4)16(20)21-15/h5-14H2,1-4H3 |
| InChIKey | KKUSMBQQSFXAMV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|