C18H33FN2 — CID 146376882
5-fluoro-1,3-dimethyl-4-(6-methyldodecan-6-yl)pyrazole (PubChem CID 146376882) has the molecular formula C18H33FN2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-4-(6-methyldodecan-6-yl)pyrazole.
| Compound Name | 5-fluoro-1,3-dimethyl-4-(6-methyldodecan-6-yl)pyrazole |
|---|---|
| PubChem CID | 146376882 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-4-(6-methyldodecan-6-yl)pyrazole |
| SMILES | CCCCCCC(C)(CCCCC)c1c(C)nn(C)c1F |
| InChI | InChI=1S/C18H33FN2/c1-6-8-10-12-14-18(4,13-11-9-7-2)16-15(3)20-21(5)17(16)19/h6-14H2,1-5H3 |
| InChIKey | XAMFQUOJYUIRPI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|