C18H31F2N — CID 146377449
3,4-difluoro-1-methyl-2-(6-methyldodecan-6-yl)pyrrole (PubChem CID 146377449) has the molecular formula C18H31F2N and a molecular weight of 299.45 g/mol. Its IUPAC name is 3,4-difluoro-1-methyl-2-(6-methyldodecan-6-yl)pyrrole.
| Compound Name | 3,4-difluoro-1-methyl-2-(6-methyldodecan-6-yl)pyrrole |
|---|---|
| PubChem CID | 146377449 |
| Molecular Formula | C18H31F2N |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 3,4-difluoro-1-methyl-2-(6-methyldodecan-6-yl)pyrrole |
| SMILES | CCCCCCC(C)(CCCCC)c1c(F)c(F)cn1C |
| InChI | InChI=1S/C18H31F2N/c1-5-7-9-11-13-18(3,12-10-8-6-2)17-16(20)15(19)14-21(17)4/h14H,5-13H2,1-4H3 |
| InChIKey | QIHXEMWJYANWCD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|