C16H13ClN2O3 — CID 129215054
3-[5-[4-(chloromethyl)phenyl]-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 129215054) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is 3-[5-[4-(chloromethyl)phenyl]-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoic acid.
| Compound Name | 3-[5-[4-(chloromethyl)phenyl]-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 129215054 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-[5-[4-(chloromethyl)phenyl]-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2=NC(c3ccc(CCl)cc3)ON2)c1 |
| InChI | InChI=1S/C16H13ClN2O3/c17-9-10-4-6-11(7-5-10)15-18-14(19-22-15)12-2-1-3-13(8-12)16(20)21/h1-8,15H,9H2,(H,18,19)(H,20,21) |
| InChIKey | QYALEDJYVDDWTC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|