C16H14N2O3 — CID 121258177
4-(5-benzyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)benzoic acid (PubChem CID 121258177) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-(5-benzyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)benzoic acid.
| Compound Name | 4-(5-benzyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 121258177 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-(5-benzyl-2,5-dihydro-1,2,4-oxadiazol-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(C2=NC(Cc3ccccc3)ON2)cc1 |
| InChI | InChI=1S/C16H14N2O3/c19-16(20)13-8-6-12(7-9-13)15-17-14(21-18-15)10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H,17,18)(H,19,20) |
| InChIKey | FAOLROWWDOHXSV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |