C12H14BrN3O3 — CID 143557078
amino 4-[5-(3-bromopropyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 143557078) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is amino 4-[5-(3-bromopropyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | amino 4-[5-(3-bromopropyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 143557078 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | amino 4-[5-(3-bromopropyl)-2,5-dihydro-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | NOC(=O)c1ccc(C2=NC(CCCBr)ON2)cc1 |
| InChI | InChI=1S/C12H14BrN3O3/c13-7-1-2-10-15-11(16-19-10)8-3-5-9(6-4-8)12(17)18-14/h3-6,10H,1-2,7,14H2,(H,15,16) |
| InChIKey | UNCCUTVNEBXWLG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|