C27H37N7O5 — CID 129215763
2-[[2-acetamido-3-(4-hydroxy-3-methylphenyl)propanoyl]amino]-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide (PubChem CID 129215763) has the molecular formula C27H37N7O5 and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-[[2-acetamido-3-(4-hydroxy-3-methylphenyl)propanoyl]amino]-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide.
| Compound Name | 2-[[2-acetamido-3-(4-hydroxy-3-methylphenyl)propanoyl]amino]-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 129215763 |
| Molecular Formula | C27H37N7O5 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 2-[[2-acetamido-3-(4-hydroxy-3-methylphenyl)propanoyl]amino]-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide |
| SMILES | CC(=O)NC(Cc1ccc(O)c(C)c1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C27H37N7O5/c1-16-13-19(10-11-23(16)36)15-22(32-17(2)35)26(39)33-20(9-6-12-31-27(29)30)25(38)34-21(24(28)37)14-18-7-4-3-5-8-18/h3-5,7-8,10-11,13,20-22,36H,6,9,12,14-15H2,1-2H3,(H2,28,37)(H,32,35)(H,33,39)(H,34,38)(H4,29,30,31) |
| InChIKey | HRBLWRYODXZJRD-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|