C22H26FN3O2 — CID 129216320
4-cyclopropyl-N-[(2S)-3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]-3-(6-fluoro-3-pyridinyl)benzamide (PubChem CID 129216320) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-cyclopropyl-N-[(2S)-3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]-3-(6-fluoro-3-pyridinyl)benzamide.
| Compound Name | 4-cyclopropyl-N-[(2S)-3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]-3-(6-fluoro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 129216320 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-cyclopropyl-N-[(2S)-3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]-3-(6-fluoro-3-pyridinyl)benzamide |
| SMILES | CNC(=O)C(C)(C)[C@H](C)NC(=O)c1ccc(C2CC2)c(-c2ccc(F)nc2)c1 |
| InChI | InChI=1S/C22H26FN3O2/c1-13(22(2,3)21(28)24-4)26-20(27)15-7-9-17(14-5-6-14)18(11-15)16-8-10-19(23)25-12-16/h7-14H,5-6H2,1-4H3,(H,24,28)(H,26,27)/t13-/m0/s1 |
| InChIKey | FTMLDNBNEIXPAT-ZDUSSCGKSA-N |
| XLogP | 3.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|