About 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide
6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide (PubChem CID 71093538) has the molecular formula C19H22ClN3O2
and a molecular weight of 359.86 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide |
| PubChem CID | 71093538 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)C(C)(C)C(C)NC(=O)c1cccc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-12(19(2,3)18(25)21-4)22-17(24)16-10-6-9-15(23-16)13-7-5-8-14(20)11-13/h5-12H,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | NKOABCOPFWJKSJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide?
The IUPAC name of 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide (CID 71093538) is 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide.
What is the SMILES notation for 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide?
The canonical SMILES for 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide is CNC(=O)C(C)(C)C(C)NC(=O)c1cccc(-c2cccc(Cl)c2)n1.
What is the InChIKey of 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide?
The InChIKey is NKOABCOPFWJKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClN3O2/c1-12(19(2,3)18(25)21-4)22-17(24)16-10-6-9-15(23-16)13-7-5-8-14(20)11-13/h5-12H,1-4H3,(H,21,25)(H,22,24).
What are the key properties of 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide?
6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide has a molecular weight of 359.86 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chlorophenyl)-N-[3,3-dimethyl-4-(methylamino)-4-oxobutan-2-yl]pyridine-2-carboxamide is sourced from PubChem (CID 71093538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).