C8H4BrF5N4O — CID 129216709
2-bromo-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 129216709) has the molecular formula C8H4BrF5N4O and a molecular weight of 347.04 g/mol. Its IUPAC name is 2-bromo-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 2-bromo-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 129216709 |
| Molecular Formula | C8H4BrF5N4O |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 2-bromo-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | FC(F)(F)C(F)(F)COc1nccn2nc(Br)nc12 |
| InChI | InChI=1S/C8H4BrF5N4O/c9-6-16-4-5(15-1-2-18(4)17-6)19-3-7(10,11)8(12,13)14/h1-2H,3H2 |
| InChIKey | LYLUTRSUSIAVDH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|