C10H9F3N2O3 — CID 129217279
[2-(3-aminoanilino)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 129217279) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is [2-(3-aminoanilino)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(3-aminoanilino)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 129217279 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [2-(3-aminoanilino)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | Nc1cccc(NC(=O)COC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2O3/c11-10(12,13)9(17)18-5-8(16)15-7-3-1-2-6(14)4-7/h1-4H,5,14H2,(H,15,16) |
| InChIKey | SYRDMDJVFLPGAP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|