C26H31F3N2O4 — CID 68603891
[2-[3-[4-[2-[(4,4-dimethylcyclohexyl)amino]ethoxy]phenyl]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 68603891) has the molecular formula C26H31F3N2O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is [2-[3-[4-[2-[(4,4-dimethylcyclohexyl)amino]ethoxy]phenyl]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[4-[2-[(4,4-dimethylcyclohexyl)amino]ethoxy]phenyl]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68603891 |
| Molecular Formula | C26H31F3N2O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [2-[3-[4-[2-[(4,4-dimethylcyclohexyl)amino]ethoxy]phenyl]anilino]-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | CC1(C)CCC(NCCOc2ccc(-c3cccc(NC(=O)COC(=O)C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C26H31F3N2O4/c1-25(2)12-10-20(11-13-25)30-14-15-34-22-8-6-18(7-9-22)19-4-3-5-21(16-19)31-23(32)17-35-24(33)26(27,28)29/h3-9,16,20,30H,10-15,17H2,1-2H3,(H,31,32) |
| InChIKey | DFRWKUPOAZRRLJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|