C23H28N2O5 — CID 9328974
[2-(3-acetamidoanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate (PubChem CID 9328974) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-(3-acetamidoanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate.
| Compound Name | [2-(3-acetamidoanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate |
|---|---|
| PubChem CID | 9328974 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [2-(3-acetamidoanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate |
| SMILES | CC(=O)Nc1cccc(NC(=O)COC(=O)CCOc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-16(26)24-18-6-5-7-19(14-18)25-21(27)15-30-22(28)12-13-29-20-10-8-17(9-11-20)23(2,3)4/h5-11,14H,12-13,15H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | IBXFWJBAPLATQK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |