C21H23F2NO4 — CID 7856014
[2-(3,4-difluoroanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate (PubChem CID 7856014) has the molecular formula C21H23F2NO4 and a molecular weight of 391.41 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate |
|---|---|
| PubChem CID | 7856014 |
| Molecular Formula | C21H23F2NO4 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 3-(4-tert-butylphenoxy)propanoate |
| SMILES | CC(C)(C)c1ccc(OCCC(=O)OCC(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C21H23F2NO4/c1-21(2,3)14-4-7-16(8-5-14)27-11-10-20(26)28-13-19(25)24-15-6-9-17(22)18(23)12-15/h4-9,12H,10-11,13H2,1-3H3,(H,24,25) |
| InChIKey | JAHHGDKBDLGQIP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |