C27H34F3NO4 — CID 123442650
N-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 123442650) has the molecular formula C27H34F3NO4 and a molecular weight of 493.57 g/mol. Its IUPAC name is N-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 123442650 |
| Molecular Formula | C27H34F3NO4 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)Nc1ccc(-c2ccc(OCCCC3CCC(C)(C)CC3)cc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H33NO2.C2HF3O2/c1-19(27)26-23-10-6-21(7-11-23)22-8-12-24(13-9-22)28-18-4-5-20-14-16-25(2,3)17-15-20;3-2(4,5)1(6)7/h6-13,20H,4-5,14-18H2,1-3H3,(H,26,27);(H,6,7) |
| InChIKey | YKLSBFJDHZJGKQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|