C27H33NO — CID 58276439
2-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]-3H-pyrrole (PubChem CID 58276439) has the molecular formula C27H33NO and a molecular weight of 387.57 g/mol. Its IUPAC name is 2-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]-3H-pyrrole.
| Compound Name | 2-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]-3H-pyrrole |
|---|---|
| PubChem CID | 58276439 |
| Molecular Formula | C27H33NO |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 2-[4-[4-[3-(4,4-dimethylcyclohexyl)propoxy]phenyl]phenyl]-3H-pyrrole |
| SMILES | CC1(C)CCC(CCCOc2ccc(-c3ccc(C4=NC=CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H33NO/c1-27(2)17-15-21(16-18-27)5-4-20-29-25-13-11-23(12-14-25)22-7-9-24(10-8-22)26-6-3-19-28-26/h3,7-14,19,21H,4-6,15-18,20H2,1-2H3 |
| InChIKey | CVHKRMDXKPBPJH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|