C18H21OP — CID 129218823
2-[(2-ethyl-6-phosphorosophenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 129218823) has the molecular formula C18H21OP and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[(2-ethyl-6-phosphorosophenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[(2-ethyl-6-phosphorosophenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 129218823 |
| Molecular Formula | C18H21OP |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[(2-ethyl-6-phosphorosophenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | CCc1cccc(P=O)c1Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H21OP/c1-5-15-7-6-8-18(20-19)17(15)11-16-13(3)9-12(2)10-14(16)4/h6-10H,5,11H2,1-4H3 |
| InChIKey | TYHFQNAFVQAUFH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|