C8H16Cl2OSi — CID 12922066
[(Z)-2,4-dichloropent-2-en-3-yl]oxy-trimethylsilane (PubChem CID 12922066) has the molecular formula C8H16Cl2OSi and a molecular weight of 227.21 g/mol. Its IUPAC name is [(Z)-2,4-dichloropent-2-en-3-yl]oxy-trimethylsilane.
| Compound Name | [(Z)-2,4-dichloropent-2-en-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 12922066 |
| Molecular Formula | C8H16Cl2OSi |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | [(Z)-2,4-dichloropent-2-en-3-yl]oxy-trimethylsilane |
| SMILES | C/C(Cl)=C(/O[Si](C)(C)C)C(C)Cl |
| InChI | InChI=1S/C8H16Cl2OSi/c1-6(9)8(7(2)10)11-12(3,4)5/h6H,1-5H3/b8-7- |
| InChIKey | ITYUOEHFKXZMEH-FPLPWBNLSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|