C7H14Cl2OSi — CID 12922062
[(Z)-1,3-dichlorobut-1-en-2-yl]oxy-trimethylsilane (PubChem CID 12922062) has the molecular formula C7H14Cl2OSi and a molecular weight of 213.18 g/mol. Its IUPAC name is [(Z)-1,3-dichlorobut-1-en-2-yl]oxy-trimethylsilane.
| Compound Name | [(Z)-1,3-dichlorobut-1-en-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 12922062 |
| Molecular Formula | C7H14Cl2OSi |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | [(Z)-1,3-dichlorobut-1-en-2-yl]oxy-trimethylsilane |
| SMILES | CC(Cl)/C(=C/Cl)O[Si](C)(C)C |
| InChI | InChI=1S/C7H14Cl2OSi/c1-6(9)7(5-8)10-11(2,3)4/h5-6H,1-4H3/b7-5- |
| InChIKey | FMXRGENZKPYBNR-ALCCZGGFSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|