C30H30F4N2O2 — CID 129222567
5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 129222567) has the molecular formula C30H30F4N2O2 and a molecular weight of 526.57 g/mol. Its IUPAC name is 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 129222567 |
| Molecular Formula | C30H30F4N2O2 |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | C[C@H]1[C@@H]2Cc3cc(OCc4cc(-c5cnc(NCC6CCOCC6)cc5C(F)(F)F)ccc4F)ccc3[C@H]12 |
| InChI | InChI=1S/C30H30F4N2O2/c1-17-24-12-20-11-22(3-4-23(20)29(17)24)38-16-21-10-19(2-5-27(21)31)25-15-36-28(13-26(25)30(32,33)34)35-14-18-6-8-37-9-7-18/h2-5,10-11,13,15,17-18,24,29H,6-9,12,14,16H2,1H3,(H,35,36)/t17-,24-,29-/m0/s1 |
| InChIKey | MVSSXOAQJVONAM-YZNPHYLBSA-N |
| XLogP | 7.23 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |