C37H35FN2O — CID 129222550
1'-[5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-6-methyl-2-pyridinyl]spiro[indene-1,4'-piperidine] (PubChem CID 129222550) has the molecular formula C37H35FN2O and a molecular weight of 542.70 g/mol. Its IUPAC name is 1'-[5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-6-methyl-2-pyridinyl]spiro[indene-1,4'-piperidine].
| Compound Name | 1'-[5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-6-methyl-2-pyridinyl]spiro[indene-1,4'-piperidine] |
|---|---|
| PubChem CID | 129222550 |
| Molecular Formula | C37H35FN2O |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 1'-[5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-6-methyl-2-pyridinyl]spiro[indene-1,4'-piperidine] |
| SMILES | Cc1nc(N2CCC3(C=Cc4ccccc43)CC2)ccc1-c1ccc(F)c(COc2ccc3c(c2)C[C@H]2[C@H](C)[C@@H]32)c1 |
| InChI | InChI=1S/C37H35FN2O/c1-23-32-21-27-20-29(8-9-31(27)36(23)32)41-22-28-19-26(7-11-34(28)38)30-10-12-35(39-24(30)2)40-17-15-37(16-18-40)14-13-25-5-3-4-6-33(25)37/h3-14,19-20,23,32,36H,15-18,21-22H2,1-2H3/t23-,32-,36-/m0/s1 |
| InChIKey | UMZOPEZPWAMFIU-ALENRHNPSA-N |
| XLogP | 8.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |