C36H34F2N4O — CID 159477432
5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-4,6-dimethylpyrimidine (PubChem CID 159477432) has the molecular formula C36H34F2N4O and a molecular weight of 576.69 g/mol. Its IUPAC name is 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-4,6-dimethylpyrimidine.
| Compound Name | 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 159477432 |
| Molecular Formula | C36H34F2N4O |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-2-(4-isocyano-4-phenylpiperidin-1-yl)-4,6-dimethylpyrimidine |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(c2nc(C)c(-c3ccc(F)c(COc4ccc5c(c4)C[C@H]4[C@H](C)[C@@H]54)c3F)c(C)n2)CC1 |
| InChI | InChI=1S/C36H34F2N4O/c1-21-29-19-24-18-26(10-11-27(24)32(21)29)43-20-30-31(37)13-12-28(34(30)38)33-22(2)40-35(41-23(33)3)42-16-14-36(39-4,15-17-42)25-8-6-5-7-9-25/h5-13,18,21,29,32H,14-17,19-20H2,1-3H3/t21-,29-,32-/m0/s1 |
| InChIKey | MSAAATCVGUVTGB-PKPTWXCBSA-N |
| XLogP | 7.94 |
| TPSA | 42.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|