C28H29F2NO4S — CID 144870885
3-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-2,4-dimethyl-6-(3-methylsulfonylpropoxy)pyridine (PubChem CID 144870885) has the molecular formula C28H29F2NO4S and a molecular weight of 513.61 g/mol. Its IUPAC name is 3-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-2,4-dimethyl-6-(3-methylsulfonylpropoxy)pyridine.
| Compound Name | 3-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-2,4-dimethyl-6-(3-methylsulfonylpropoxy)pyridine |
|---|---|
| PubChem CID | 144870885 |
| Molecular Formula | C28H29F2NO4S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 3-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-2,4-dimethyl-6-(3-methylsulfonylpropoxy)pyridine |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)nc(C)c1-c1ccc(F)c(COc2ccc3c(c2)CC2CC32)c1F |
| InChI | InChI=1S/C28H29F2NO4S/c1-16-11-26(34-9-4-10-36(3,32)33)31-17(2)27(16)22-7-8-25(29)24(28(22)30)15-35-20-5-6-21-18(13-20)12-19-14-23(19)21/h5-8,11,13,19,23H,4,9-10,12,14-15H2,1-3H3 |
| InChIKey | MLNHNMDHSPLBNP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|