C17H14BFO — CID 123142701
CID 123142701 (PubChem CID 123142701) has the molecular formula C17H14BFO and a molecular weight of 264.11 g/mol.
| Compound Name | CID 123142701 |
|---|---|
| PubChem CID | 123142701 |
| Molecular Formula | C17H14BFO |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(F)c(COc2ccc3c(c2)CC2CC32)c1 |
| InChI | InChI=1S/C17H14BFO/c18-13-1-4-17(19)12(6-13)9-20-14-2-3-15-10(7-14)5-11-8-16(11)15/h1-4,6-7,11,16H,5,8-9H2 |
| InChIKey | NFVOILRINGBRHX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|