C30H33FO4S — CID 139322361
1-(4-cyclopropylphenoxy)-4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-7-fluoro-2,3-dihydro-1H-indene (PubChem CID 139322361) has the molecular formula C30H33FO4S and a molecular weight of 508.66 g/mol. Its IUPAC name is 1-(4-cyclopropylphenoxy)-4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-7-fluoro-2,3-dihydro-1H-indene.
| Compound Name | 1-(4-cyclopropylphenoxy)-4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-7-fluoro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 139322361 |
| Molecular Formula | C30H33FO4S |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 1-(4-cyclopropylphenoxy)-4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-7-fluoro-2,3-dihydro-1H-indene |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1ccc(F)c2c1CCC2Oc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C30H33FO4S/c1-19-17-24(34-15-4-16-36(3,32)33)18-20(2)29(19)25-11-13-27(31)30-26(25)12-14-28(30)35-23-9-7-22(8-10-23)21-5-6-21/h7-11,13,17-18,21,28H,4-6,12,14-16H2,1-3H3 |
| InChIKey | RABOYPNVYIZTGG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|