C30H31NO6S — CID 52919103
5-[4-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-oxazol-3-one (PubChem CID 52919103) has the molecular formula C30H31NO6S and a molecular weight of 533.65 g/mol. Its IUPAC name is 5-[4-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-oxazol-3-one.
| Compound Name | 5-[4-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 52919103 |
| Molecular Formula | C30H31NO6S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 5-[4-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-oxazol-3-one |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1cccc2c1CCC2Oc1ccc(-c2cc(=O)[nH]o2)cc1 |
| InChI | InChI=1S/C30H31NO6S/c1-19-16-23(35-14-5-15-38(3,33)34)17-20(2)30(19)26-7-4-6-25-24(26)12-13-27(25)36-22-10-8-21(9-11-22)28-18-29(32)31-37-28/h4,6-11,16-18,27H,5,12-15H2,1-3H3,(H,31,32) |
| InChIKey | OBCAGBPEIOOTHR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|