C32H34F2O5 — CID 146504926
trans-(1S,2S)-2-[4-[[(1R)-5,7-difluoro-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 146504926) has the molecular formula C32H34F2O5 and a molecular weight of 536.62 g/mol. Its IUPAC name is trans-(1S,2S)-2-[4-[[(1R)-5,7-difluoro-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[4-[[(1R)-5,7-difluoro-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 146504926 |
| Molecular Formula | C32H34F2O5 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | trans-(1S,2S)-2-[4-[[(1R)-5,7-difluoro-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1cc(OCCC(C)(C)O)cc(C)c1-c1c(F)cc(F)c2c1CC[C@H]2Oc1ccc([C@H]2C[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C32H34F2O5/c1-17-13-21(38-12-11-32(3,4)37)14-18(2)28(17)30-22-9-10-27(29(22)25(33)16-26(30)34)39-20-7-5-19(6-8-20)23-15-24(23)31(35)36/h5-8,13-14,16,23-24,27,37H,9-12,15H2,1-4H3,(H,35,36)/t23-,24+,27-/m1/s1 |
| InChIKey | ZEZWOQVCOKSMBP-ONBPZOJHSA-N |
| XLogP | 7.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |