C13H19N2+ — CID 129223790
1,5-di(propan-2-yl)pyrrolo[3,2-c]pyridin-5-ium (PubChem CID 129223790) has the molecular formula C13H19N2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is 1,5-di(propan-2-yl)pyrrolo[3,2-c]pyridin-5-ium.
| Compound Name | 1,5-di(propan-2-yl)pyrrolo[3,2-c]pyridin-5-ium |
|---|---|
| PubChem CID | 129223790 |
| Molecular Formula | C13H19N2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1,5-di(propan-2-yl)pyrrolo[3,2-c]pyridin-5-ium |
| SMILES | CC(C)n1ccc2c[n+](C(C)C)ccc21 |
| InChI | InChI=1S/C13H19N2/c1-10(2)14-7-6-13-12(9-14)5-8-15(13)11(3)4/h5-11H,1-4H3/q+1 |
| InChIKey | QKBQYAVEIOTLAY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|