C21H20F3N2O2+ — CID 176809797
2-(1-propan-2-ylpyrrolo[3,2-c]pyridin-5-ium-5-yl)-7-(trifluoromethoxy)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 176809797) has the molecular formula C21H20F3N2O2+ and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-(1-propan-2-ylpyrrolo[3,2-c]pyridin-5-ium-5-yl)-7-(trifluoromethoxy)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-(1-propan-2-ylpyrrolo[3,2-c]pyridin-5-ium-5-yl)-7-(trifluoromethoxy)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 176809797 |
| Molecular Formula | C21H20F3N2O2+ |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-(1-propan-2-ylpyrrolo[3,2-c]pyridin-5-ium-5-yl)-7-(trifluoromethoxy)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(C)n1ccc2c[n+](C3CCc4ccc(OC(F)(F)F)cc4C3=O)ccc21 |
| InChI | InChI=1S/C21H20F3N2O2/c1-13(2)26-10-7-15-12-25(9-8-18(15)26)19-6-4-14-3-5-16(28-21(22,23)24)11-17(14)20(19)27/h3,5,7-13,19H,4,6H2,1-2H3/q+1 |
| InChIKey | FCLDQOQBMDDDPL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|