C25H24N6O5S — CID 129224311
6-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]pyridine-3-carboxamide (PubChem CID 129224311) has the molecular formula C25H24N6O5S and a molecular weight of 520.57 g/mol. Its IUPAC name is 6-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]pyridine-3-carboxamide.
| Compound Name | 6-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129224311 |
| Molecular Formula | C25H24N6O5S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 6-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-N-[1-[(3-methylphenyl)methyl]imidazol-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1cccc(Cn2cnc(NC(=O)c3ccc(CN(C)S(=O)(=O)c4ccccc4[N+](=O)[O-])nc3)c2)c1 |
| InChI | InChI=1S/C25H24N6O5S/c1-18-6-5-7-19(12-18)14-30-16-24(27-17-30)28-25(32)20-10-11-21(26-13-20)15-29(2)37(35,36)23-9-4-3-8-22(23)31(33)34/h3-13,16-17H,14-15H2,1-2H3,(H,28,32) |
| InChIKey | ZHCJZHITTKBXHY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|